Solved

Which of the Following Is the Equilibrium Constant Expression for the Reverse

Question 97

Multiple Choice

Which of the following is the equilibrium constant expression for the reverse reaction of the following reaction? Which of the following is the equilibrium constant expression for the reverse reaction of the following reaction? A) K = [CH<sub>3</sub>COOH][C<sub>2</sub>H<sub>5</sub>OH]/[CH<sub>3</sub>COOC<sub>2</sub>H<sub>5</sub>][H<sub>2</sub>O] B) K = [CH<sub>3</sub>COOC<sub>2</sub>H<sub>5</sub>][H<sub>2</sub>O]/[CH<sub>3</sub>COOH][C<sub>2</sub>H<sub>5</sub>OH] C) K = [CH<sub>3</sub>COOH][C<sub>2</sub>H<sub>5</sub>OH]/[CH<sub>3</sub>COOC<sub>2</sub>H<sub>5</sub>] D) K = [CH<sub>3</sub>COOC<sub>2</sub>H<sub>5</sub>]/[CH<sub>3</sub>COOH][C<sub>2</sub>H<sub>5</sub>OH]


A) K = [CH3COOH][C2H5OH]/[CH3COOC2H5][H2O]
B) K = [CH3COOC2H5][H2O]/[CH3COOH][C2H5OH]
C) K = [CH3COOH][C2H5OH]/[CH3COOC2H5]
D) K = [CH3COOC2H5]/[CH3COOH][C2H5OH]

Correct Answer:

verifed

Verified

Unlock this answer now
Get Access to more Verified Answers free of charge

Related Questions

Q92: Which of the following is true of

Q93: Which of the following units can used

Q94: For the reaction 2C → A +

Q95: Consider the following energy diagram for a

Q96: Which of the following accounts for the

Q98: Which of the following will not change

Q99: Drug manufacturers use which of the following

Q100: A catalyst speeds up a chemical reaction

Q101: Many molecular collisions do not result in

Q102: In a particular chemical reaction, four bonds