Question 1

A flask of 0.25 M HBrO(aq)has what pH? (pKa = 8.69)

Accepted Answer

A) 5.90 
B) 0.60 
C) 8.10 
D) 4.65 
E) 9.30 
A) 5.90 
B) 0.60 
C) 8.10 
D) 4.65 
E) 9.30

Question 2

When CaO(s)is dissolved in water,which of the following is true?

Accepted Answer

A) The solution contains O2F1F1F1S1F1F1F10(aq), OHF1F1F1S1F1F1F10(aq), and Ca2+(aq). 
B) The solution contains CaO(aq). 
C) CaO(s)does not dissolve in water. 
D) The solution contains O2F1F1F1S1F1F1F10(aq)and Ca2+(aq). 
E) The solution contains OHF1F1F1S1F1F1F10(aq)and Ca2+(aq). 
A) The solution contains O2F1F1F1S1F1F1F10(aq), OHF1F1F1S1F1F1F10(aq), and Ca2+(aq). 
B) The solution contains CaO(aq). 
C) CaO(s)does not dissolve in water. 
D) The solution contains O2F1F1F1S1F1F1F10(aq)and Ca2+(aq). 
E) The solution contains OHF1F1F1S1F1F1F10(aq)and Ca2+(aq).

Question 3

For a solution labeled "0.10 M H2SO3(aq)," pKa1 = 1.81 and pKa2 = 6.91,which of the following is true?

Accepted Answer

A) [H+] = 0.2 M. 
B) The pH is 1.0. 
C) The pH ~1.5. 
D) The pH is 0.70. 
E) The pH ~ 4.4. 
A) [H+] = 0.2 M. 
B) The pH is 1.0. 
C) The pH ~1.5. 
D) The pH is 0.70. 
E) The pH ~ 4.4.

Question 4

Write the charge balance equation for a solution that is 0.0010 M phenol(aq).Let phenol be represented by HA(aq).

Accepted Answer

A) [H3O+] = [OHF1F1F1S1F1F1F10] 
B) Kw = [H3O+][OHF1F1F1S1F1F1F10] 
C) [H3O+] = [OHF1F1F1S1F1F1F10] + [AF1F1F1S1F1F1F10] 
D) Ka = Kw/Kb  
E) 0.0010 = [HA] + [AF1F1F1S1F1F1F10] 
A) [H3O+] = [OHF1F1F1S1F1F1F10] 
B) Kw = [H3O+][OHF1F1F1S1F1F1F10] 
C) [H3O+] = [OHF1F1F1S1F1F1F10] + [AF1F1F1S1F1F1F10] 
D) Ka = Kw/Kb  
E) 0.0010 = [HA] + [AF1F1F1S1F1F1F10]

Question 5

When sulfur trioxide dissolves in water,sulfuric acid is produced.An intermediate in the reaction is H2O-SO3.In the reaction of the intermediate to produce sulfuric acid,

Accepted Answer

A) water acts both as an acid and a base. 
B) water acts as a proton donor only. 
C) water acts as a proton acceptor only. 
D) the intermediate undergoes an intramolecular rearrangement to form the product. 
A) water acts both as an acid and a base. 
B) water acts as a proton donor only. 
C) water acts as a proton acceptor only. 
D) the intermediate undergoes an intramolecular rearrangement to form the product.

Question 6

Calculate the equilibrium concentration of sulfurous acid in a solution labeled "0.100 M H2SO3(aq)" if pKa1 = 1.81,and pKa2 = 6.91.

Accepted Answer

A) 0.068 M 
B) 0.015 M 
C) 0.100 M 
D) 0.050 M 
E) 0.032 M 
A) 0.068 M 
B) 0.015 M 
C) 0.100 M 
D) 0.050 M 
E) 0.032 M

Question 7

The amino acid alanine,HOOC-CH(CH3)NH3+,has Ka1 = 4.5 F1F1F1S1F1F1F10 10F1F1F1S1F1F1F103 and Ka2 = 1.4 F1F1F1S1F1F1F10 10F1F1F1S1F1F1F1010.Calculate F1F1F1S1F1F1F10(HOOC-CH(CH3)NH3+)at pH 3.

Accepted Answer

A) 0 
B) 0.82 
C) 0.58 
D) 0.29 
E) 0.18 
A) 0 
B) 0.82 
C) 0.58 
D) 0.29 
E) 0.18

Question 8

Which of the following 0.10 M aqueous solutions gives the lowest pH?

Accepted Answer

A) CCl3COOH (pKa = 0.52) 
B) Because all are acids, the pH is the same for all solutions. 
C) HF (pKa = 3.45) 
D) CH3COOH (pKa = 4.75) 
E) H3PO4 (pKa1 = 2.12) 
A) CCl3COOH (pKa = 0.52) 
B) Because all are acids, the pH is the same for all solutions. 
C) HF (pKa = 3.45) 
D) CH3COOH (pKa = 4.75) 
E) H3PO4 (pKa1 = 2.12)

Question 9

What is the conjugate base of H2PO4F1F1F1S1F1F1F10 ?

Accepted Answer

A) HPO42F1F1F1S1F1F1F10 
B) OHF1F1F1S1F1F1F10 
C) H3PO4 
D) H2PO4F1F1F1S1F1F1F10 
E) PO43F1F1F1S1F1F1F10 
A) HPO42F1F1F1S1F1F1F10 
B) OHF1F1F1S1F1F1F10 
C) H3PO4 
D) H2PO4F1F1F1S1F1F1F10 
E) PO43F1F1F1S1F1F1F10

Question 10

The amino acid alanine,HOOC-CH(CH3)NH3+,has Ka1 = 4.5 F1F1F1S1F1F1F10 10F1F1F1S1F1F1F103 and Ka2 = 1.4 F1F1F1S1F1F1F10 10F1F1F1S1F1F1F1010.Calculate F1F1F1S1F1F1F10(F1F1F1S1F1F1F10OOC-CH(CH3)NH3+)at pH 3.

Accepted Answer

A) 0 
B) 0.82 
C) 0.18 
D) 0.29 
E) 0.58 
A) 0 
B) 0.82 
C) 0.18 
D) 0.29 
E) 0.58

Question 11

The pH of 0.010 M aniline(aq)is 8.32.What is the percentage aniline protonated?

Accepted Answer

A) 2.1% 
B) 0.69% 
C) 0.021% 
D) 0.12% 
E) 0.21% 
A) 2.1% 
B) 0.69% 
C) 0.021% 
D) 0.12% 
E) 0.21%

Question 12

Which of the following is the conjugate acid of H2PO4F1F1F1S1F1F1F10?

Accepted Answer

A) PO43F1F1F1S1F1F1F10 
B) OHF1F1F1S1F1F1F10 
C) H3PO4 
D) H2PO4F1F1F1S1F1F1F10 
E) HPO42F1F1F1S1F1F1F10 
A) PO43F1F1F1S1F1F1F10 
B) OHF1F1F1S1F1F1F10 
C) H3PO4 
D) H2PO4F1F1F1S1F1F1F10 
E) HPO42F1F1F1S1F1F1F10

Question 13

Is a 0.1 M aqueous solution of HPO42F1F1F1S1F1F1F10 acidic,basic,or neutral? Prove your answer using the appropriate equilibrium constants.

Accepted Answer

basic,K_b (HPO₄²F1F1F1S1^F1F1F10)=

Question 14

If the pKa1 = 1.81,and pKa2 = 6.91 for a 0.05 M solution of H2SeO3,what is its [H+]?

Accepted Answer

A) 0.015 M 
B) 0.021 M 
C) 0.025 M 
D) 0.029 M 
E) 0.050 M 
A) 0.015 M 
B) 0.021 M 
C) 0.025 M 
D) 0.029 M 
E) 0.050 M

A flask of 0.25 M HBrO(aq)has what pH? (pK_a = 8.69)

When CaO(s)is dissolved in water,which of the following is true?

For a solution labeled "0.10 M H₂SO₃(aq)," pK_a1 = 1.81 and pK_a2 = 6.91,which of the following is true?

Write the charge balance equation for a solution that is 0.0010 M phenol(aq).Let phenol be represented by HA(aq).

When sulfur trioxide dissolves in water,sulfuric acid is produced.An intermediate in the reaction is H₂O-SO₃.In the reaction of the intermediate to produce sulfuric acid,

Calculate the equilibrium concentration of sulfurous acid in a solution labeled "0.100 M H₂SO₃(aq)" if pK_a1 = 1.81,and pK_a2 = 6.91.

The amino acid alanine,HOOC-CH(CH₃)NH₃⁺,has K_a1 = 4.5  10^³ and K_a2 = 1.4  10^¹⁰.Calculate (HOOC-CH(CH₃)NH₃⁺)at pH 3.

Which of the following 0.10 M aqueous solutions gives the lowest pH?

What is the conjugate base of H₂PO₄^ ?

The amino acid alanine,HOOC-CH(CH₃)NH₃⁺,has K_a1 = 4.5  10^³ and K_a2 = 1.4  10^¹⁰.Calculate (^OOC-CH(CH₃)NH₃⁺)at pH 3.

The pH of 0.010 M aniline(aq)is 8.32.What is the percentage aniline protonated?

Which of the following is the conjugate acid of H₂PO₄^?

Is a 0.1 M aqueous solution of HPO₄²^ acidic,basic,or neutral? Prove your answer using the appropriate equilibrium constants.

If the pK_a1 = 1.81,and pK_a2 = 6.91 for a 0.05 M solution of H₂SeO₃,what is its [H⁺]?

The Quantum World

Quantum Mechanics in Action: Atoms

Chemical Bonds

Molecular Shape and Structure

The Properties of Gases

Liquids and Solids

Inorganic Materials

Thermodynamics: the First Law

Thermodynamics: the Second and Third Laws

Physical Equilibria

Chemical Equilibria

Aqueous Equilibria

Electrochemistry

Chemical Kinetics

The Elements: the Main Group Elements

The Elements: the D Block

Nuclear Chemistry

Organic Chemistry I

Organic Chemistry II

Filters

Exam 12: Acids and Bases

A flask of 0.25 M HBrO(aq)has what pH? (pKa = 8.69)

When CaO(s)is dissolved in water,which of the following is true?

For a solution labeled "0.10 M H2SO3(aq)," pKa1 = 1.81 and pKa2 = 6.91,which of the following is true?

Write the charge balance equation for a solution that is 0.0010 M phenol(aq).Let phenol be represented by HA(aq).

When sulfur trioxide dissolves in water,sulfuric acid is produced.An intermediate in the reaction is H2O-SO3.In the reaction of the intermediate to produce sulfuric acid,

Calculate the equilibrium concentration of sulfurous acid in a solution labeled "0.100 M H2SO3(aq)" if pKa1 = 1.81,and pKa2 = 6.91.

The amino acid alanine,HOOC-CH(CH3)NH3+,has Ka1 = 4.5  103 and Ka2 = 1.4  1010.Calculate (HOOC-CH(CH3)NH3+)at pH 3.

Which of the following 0.10 M aqueous solutions gives the lowest pH?

What is the conjugate base of H2PO4 ?

The amino acid alanine,HOOC-CH(CH3)NH3+,has Ka1 = 4.5  103 and Ka2 = 1.4  1010.Calculate (OOC-CH(CH3)NH3+)at pH 3.

The pH of 0.010 M aniline(aq)is 8.32.What is the percentage aniline protonated?

Which of the following is the conjugate acid of H2PO4?

Is a 0.1 M aqueous solution of HPO42 acidic,basic,or neutral? Prove your answer using the appropriate equilibrium constants.

If the pKa1 = 1.81,and pKa2 = 6.91 for a 0.05 M solution of H2SeO3,what is its [H+]?

The Quantum World

Quantum Mechanics in Action: Atoms

Chemical Bonds

Molecular Shape and Structure

The Properties of Gases

Liquids and Solids

Inorganic Materials

Thermodynamics: the First Law

Thermodynamics: the Second and Third Laws

Physical Equilibria

Chemical Equilibria

Aqueous Equilibria

Electrochemistry

Chemical Kinetics

The Elements: the Main Group Elements

The Elements: the D Block

Nuclear Chemistry

Organic Chemistry I

Organic Chemistry II

Filters

A flask of 0.25 M HBrO(aq)has what pH? (pK_a = 8.69)

For a solution labeled "0.10 M H₂SO₃(aq)," pK_a1 = 1.81 and pK_a2 = 6.91,which of the following is true?

When sulfur trioxide dissolves in water,sulfuric acid is produced.An intermediate in the reaction is H₂O-SO₃.In the reaction of the intermediate to produce sulfuric acid,

Calculate the equilibrium concentration of sulfurous acid in a solution labeled "0.100 M H₂SO₃(aq)" if pK_a1 = 1.81,and pK_a2 = 6.91.

The amino acid alanine,HOOC-CH(CH₃)NH₃⁺,has K_a1 = 4.5  10^³ and K_a2 = 1.4  10^¹⁰.Calculate (HOOC-CH(CH₃)NH₃⁺)at pH 3.

What is the conjugate base of H₂PO₄^ ?

The amino acid alanine,HOOC-CH(CH₃)NH₃⁺,has K_a1 = 4.5  10^³ and K_a2 = 1.4  10^¹⁰.Calculate (^OOC-CH(CH₃)NH₃⁺)at pH 3.

Which of the following is the conjugate acid of H₂PO₄^?

Is a 0.1 M aqueous solution of HPO₄²^ acidic,basic,or neutral? Prove your answer using the appropriate equilibrium constants.

If the pK_a1 = 1.81,and pK_a2 = 6.91 for a 0.05 M solution of H₂SeO₃,what is its [H⁺]?