Given the following equilibria, Ni2+(aq)+ 2 OH-(aq) Ni(OH)2(s)$~~~~~~~~$ K1 = 1.8 $\times$ 1015 Ni2+(aq)+ 4 CN-(aq) Ni(CN)42-(aq)$~~ ~~ $ K2 = 2.0 $\times$1031 Determine the equilibrium constant,Kc,for the following reaction. Ni(OH)2(s)+ 4 CN-(aq) Ni(CN)42-(aq)+ 2 OH-(aq)

A) 2.8 $\times$ 10-47 B) 9.0 $\times$ 10-17 C) 1.8 $\times$ 1015 D) 1.1 $\times$ 1016 E) 3.6 $\times$ 1046 A) 2.8 $\times$ 10-47 B) 9.0 $\times$ 10-17 C) 1.8 $\times$ 1015 D) 1.1 $\times$ 1016 E) 3.6 $\times$ 1046

Given the equilibrium constants for the following reactions: 4Cu(s)+ O2(g) 2Cu2O(s),K1 4CuO(s) 2Cu2O(s)+ O2(g),K2 What is K for the system 2Cu(s)+ O2(g) 2CuO(s) Equivalent to?

A) B) C) (K1)(K2) D) E) A) B) C) (K1)(K2) D) E)

The thermochemical equation for the formation of ammonia from elemental nitrogen and hydrogen is as follows. N2(g)+ 3 H2(g) 2 NH3(g)$~~~~~~~~$ $~~~~~~~~$ $\Delta$H = -92.2 kJ Given a system that is initially at equilibrium,which of the following actions cause the reaction to proceed to the left?

A) adding N2(g) B) removing NH3(g) C) adding a catalyst D) decreasing the temperature E) removing H2(g) A) adding N2(g) B) removing NH3(g) C) adding a catalyst D) decreasing the temperature E) removing H2(g)

At a given temperature,K = 0.021 for the equilibrium: PCl5(g) PCl3(g)+ Cl2(g) What is K for: Cl2(g)+ PCl3(g) PCl5(g)?

A) 2300 B) 21 C) 0.00044 D) 48 E) 0.021 A) 2300 B) 21 C) 0.00044 D) 48 E) 0.021

The equilibrium constant,Kc,for the decomposition of ammonium hydrogen sulfide is 1.8 $\times$ 10-4 at 25 S1U1P1$\circ$S1S1P0C.NH4HS(s) NH3(g)+ H2S(g) If excess NH4HS(s)is allowed to equilibrate at 25 S1U1P1$\circ$S1S1P0C,what is the equilibrium concentration of NH3?

A) 3.2 $\times$ 10-8 M B) 9.0 $\times$ 10-5 M C) 1.8 $\times$ 10-4 M D) 6.7 $\times$ 10-3 M E) 1.3 $\times$ 10-2 M A) 3.2 $\times$ 10-8 M B) 9.0 $\times$ 10-5 M C) 1.8 $\times$ 10-4 M D) 6.7 $\times$ 10-3 M E) 1.3 $\times$ 10-2 M

Consider the following equilibrium: CO2(g)+ H2(g) CO(g)+ H2O(g); Kc = 1.6 at 1260 K Suppose 0.038 mol CO2 and 0.022 mol H2 are placed in a 1.50-L vessel at 1260 K.What is the equilibrium partial pressure of CO(g)? (R = 0.0821 L · atm/K·mol)

A) 9.9 atm B) 1.1 atm C) 4.1 atm D) 2.6 atm E) 1.5 atm A) 9.9 atm B) 1.1 atm C) 4.1 atm D) 2.6 atm E) 1.5 atm

Exam 16: Principles of Reactivity: Chemical Equilibria

Given the following equilibria, Ni²⁺(aq)+ 2 OH^-(aq) $Given the following equilibria, Ni2+(aq)+ 2 OH-(aq) Ni(OH)2(s) ~~~~ K1 = 1.8 \times 1015 Ni2+(aq)+ 4 CN-(aq) Ni(CN)42-(aq) K2 = 2.0 \times 1031 Determine the equilibrium constant,Kc,for the following reaction. Ni(OH)2(s)+ 4 CN-(aq) Ni(CN)42-(aq)+ 2 OH-(aq)$ Ni(OH)₂(s) $$ K₁ = 1.8 $\times$ 10¹⁵ Ni²⁺(aq)+ 4 CN^-(aq) $Given the following equilibria, Ni2+(aq)+ 2 OH-(aq) Ni(OH)2(s) K1 = 1.8 \times 1015 Ni2+(aq)+ 4 CN-(aq) Ni(CN)42-(aq) K2 = 2.0 \times 1031 Determine the equilibrium constant,Kc,for the following reaction. Ni(OH)2(s)+ 4 CN-(aq) Ni(CN)42-(aq)+ 2 OH-(aq)$ Ni(CN)₄^2-(aq) $ $ K₂ = 2.0 $\times$ 10³¹ Determine the equilibrium constant,K_c,for the following reaction. Ni(OH)₂(s)+ 4 CN^-(aq) $Given the following equilibria, Ni2+(aq)+ 2 OH-(aq) Ni(OH)2(s) K1 = 1.8 \times 1015 Ni2+(aq)+ 4 CN-(aq) Ni(CN)42-(aq) K2 = 2.0 \times 1031 Determine the equilibrium constant,Kc,for the following reaction. Ni(OH)2(s)+ 4 CN-(aq) Ni(CN)42-(aq)+ 2 OH-(aq)$ Ni(CN)₄^2-(aq)+ 2 OH^-(aq)

(Multiple Choice)

4.9/5

(43)

Question 21

Given the equilibrium constants for the following reactions: 4Cu(s)+ O₂(g) 2Cu₂O(s),K₁ 4CuO(s) 2Cu₂O(s)+ O₂(g),K₂ What is K for the system 2Cu(s)+ O₂(g) 2CuO(s) Equivalent to?

(Multiple Choice)

4.7/5

(41)

Question 22

The thermochemical equation for the formation of ammonia from elemental nitrogen and hydrogen is as follows. N₂(g)+ 3 H₂(g) $The thermochemical equation for the formation of ammonia from elemental nitrogen and hydrogen is as follows. N2(g)+ 3 H2(g) 2 NH3(g) \Delta H = -92.2 kJ Given a system that is initially at equilibrium,which of the following actions cause the reaction to proceed to the left?$ 2 NH₃(g) $$ $$ $\Delta$ H = -92.2 kJ Given a system that is initially at equilibrium,which of the following actions cause the reaction to proceed to the left?

(Multiple Choice)

4.9/5

(35)

Question 23

Sulfuryl chloride decomposes to sulfur dioxide and chlorine. SO₂Cl₂(g) SO₂(g)+ Cl₂(g) K_c is 0.045 at 648 K.If an initial concentration of 0.075 M SO₂Cl₂ is allowed to equilibrate,what is the equilibrium concentration of Cl₂?

(Multiple Choice)

4.8/5

(35)

Question 24

At a given temperature,K = 0.021 for the equilibrium: PCl₅(g) PCl₃(g)+ Cl₂(g) What is K for: Cl₂(g)+ PCl₃(g) PCl₅(g)?

(Multiple Choice)

4.9/5

(36)

Question 25

For the reaction given below,2.00 moles of A and 3.00 moles of B are placed in a 6.00-L container. A(g)+ 2B(g) C(g) At equilibrium,the concentration of A is 0.223 mol/L.What is the value of K_c?

(Multiple Choice)

4.8/5

(35)

Question 26

Which of the following statements about the reaction quotient,Q,is false?

(Multiple Choice)

4.9/5

(38)

Question 27

The equilibrium constant,K_c,for the decomposition of ammonium hydrogen sulfide is 1.8 $\times$ 10^-4 at 25 ^$\circ$C.NH₄HS(s) $The equilibrium constant,Kc,for the decomposition of ammonium hydrogen sulfide is 1.8 \times 10-4 at 25 \circ C.NH4HS(s) NH3(g)+ H2S(g) If excess NH4HS(s)is allowed to equilibrate at 25 \circ C,what is the equilibrium concentration of NH3?$ NH₃(g)+ H₂S(g) If excess NH₄HS(s)is allowed to equilibrate at 25 ^$\circ$C,what is the equilibrium concentration of NH₃?

(Multiple Choice)

4.9/5

(31)

Question 28

If the reaction quotient,Q,is greater than K in a gas phase reaction,then

(Multiple Choice)

4.9/5

(38)

Question 29

Consider the reaction H₂ + I₂ 2HI for which K_c = 43.6 at a high temperature.If an equimolar mixture of reactants gives the concentration of the product to be 0.50 M at equilibrium,determine the equilibrium concentration of the hydrogen.

(Multiple Choice)

4.8/5

(38)

Question 30

Write a balanced chemical equation which corresponds to the following equilibrium constant expression.

(Multiple Choice)

4.8/5

(35)

Question 31

Which of the following equilibria would not be affected by pressure changes at constant temperature?

(Multiple Choice)

4.7/5

(36)

Question 32

If the reaction quotient,Q,is equal to K in a gas phase reaction,then

(Multiple Choice)

4.7/5

(46)

Question 33

For the equilibrium PCl₅(g) PCl₃(g)+ Cl₂(g),K_c = 4.0 at 228°C.If pure PCl₅ is placed in a 1.00-L container and allowed to come to equilibrium,and the equilibrium concentration of PCl₅(g)is 0.26 M,what is the equilibrium concentration of PCl₃?

(Multiple Choice)

4.7/5

(31)

Question 34

For the reaction TlSCN(s) $For the reaction TlSCN(s) Tl+(aq)+ SCN-(aq),Kc = At 25 \circ C.Which of the following concerning a 125 mL solution containing M Tl+, M SCN- and a large excess of TlSCN(s)is/are correct? 1)The mixture is at equilibrium. 2)Additional TlSCN(s)must precipitate to attain equilibrium. 3)The reaction quotient (Q)is greater than one.$ Tl⁺(aq)+ SCN^-(aq),K_c = $For the reaction TlSCN(s) Tl+(aq)+ SCN-(aq),Kc = At 25 \circ C.Which of the following concerning a 125 mL solution containing M Tl+, M SCN- and a large excess of TlSCN(s)is/are correct? 1)The mixture is at equilibrium. 2)Additional TlSCN(s)must precipitate to attain equilibrium. 3)The reaction quotient (Q)is greater than one.$ At 25^$\circ$C.Which of the following concerning a 125 mL solution containing $For the reaction TlSCN(s) Tl+(aq)+ SCN-(aq),Kc = At 25 \circ C.Which of the following concerning a 125 mL solution containing M Tl+, M SCN- and a large excess of TlSCN(s)is/are correct? 1)The mixture is at equilibrium. 2)Additional TlSCN(s)must precipitate to attain equilibrium. 3)The reaction quotient (Q)is greater than one.$ M Tl⁺, $For the reaction TlSCN(s) Tl+(aq)+ SCN-(aq),Kc = At 25 \circ C.Which of the following concerning a 125 mL solution containing M Tl+, M SCN- and a large excess of TlSCN(s)is/are correct? 1)The mixture is at equilibrium. 2)Additional TlSCN(s)must precipitate to attain equilibrium. 3)The reaction quotient (Q)is greater than one.$ M SCN^- and a large excess of TlSCN(s)is/are correct? 1)The mixture is at equilibrium. 2)Additional TlSCN(s)must precipitate to attain equilibrium. 3)The reaction quotient (Q)is greater than one.

(Multiple Choice)

4.8/5

(48)

Question 35

For the equilibrium PCl₅(g) $For the equilibrium PCl5(g) PCl3(g)+ Cl2(g),Kc = 2.0 \times 101 at 240°C.If pure PCl5 is placed in a 1.00-L container and allowed to come to equilibrium,and the equilibrium concentration of PCl3(g)is 0.23 M,what is the equilibrium concentration of PCl5(g)?$ PCl₃(g)+ Cl₂(g),K_c = 2.0 $\times$ 10¹ at 240°C.If pure PCl₅ is placed in a 1.00-L container and allowed to come to equilibrium,and the equilibrium concentration of PCl₃(g)is 0.23 M,what is the equilibrium concentration of PCl₅(g)?

(Multiple Choice)

4.9/5

(36)

Question 36

Which expression correctly describes the equilibrium constant K_c for the following reaction?

(Multiple Choice)

4.9/5

(38)

Question 37

A flask contains the following chemical system at equilibrium. CuCO₃(s) Cu²⁺(aq)+ 2 CO₃^2-(aq) Addition of which of the following substances will increase the solubility of CuCO₃(s)in water? 1)aqueous hydrochloric acid 2)aqueous sodium carbonate 3)solid copper(II)carbonate

(Multiple Choice)

4.8/5

(27)

Question 38

At a given temperature,0.0664 mol N₂O₄(g)is placed in a 1.00 L flask.After reaching equilibrium,the concentration of NO₂(g)is 6.1 $\times$ 10^-3 M.What is K_c for the reaction below? $At a given temperature,0.0664 mol N2O4(g)is placed in a 1.00 L flask.After reaching equilibrium,the concentration of NO2(g)is 6.1 \times 10-3 M.What is Kc for the reaction below?$

(Multiple Choice)

4.8/5

(42)

Question 39

Consider the following equilibrium: CO₂(g)+ H₂(g) CO(g)+ H₂O(g); K_c = 1.6 at 1260 K Suppose 0.038 mol CO₂ and 0.022 mol H₂are placed in a 1.50-L vessel at 1260 K.What is the equilibrium partial pressure of CO(g)? (R = 0.0821 L · atm/K·mol)

(Multiple Choice)

4.8/5

(34)

Question 40

Showing 21 - 40 of 82

Given the equilibrium constants for the following reactions: 4Cu(s)+ O₂(g) 2Cu₂O(s),K₁ 4CuO(s) 2Cu₂O(s)+ O₂(g),K₂ What is K for the system 2Cu(s)+ O₂(g) 2CuO(s) Equivalent to?

Sulfuryl chloride decomposes to sulfur dioxide and chlorine. SO₂Cl₂(g) SO₂(g)+ Cl₂(g) K_c is 0.045 at 648 K.If an initial concentration of 0.075 M SO₂Cl₂ is allowed to equilibrate,what is the equilibrium concentration of Cl₂?

At a given temperature,K = 0.021 for the equilibrium: PCl₅(g) PCl₃(g)+ Cl₂(g) What is K for: Cl₂(g)+ PCl₃(g) PCl₅(g)?

For the reaction given below,2.00 moles of A and 3.00 moles of B are placed in a 6.00-L container. A(g)+ 2B(g) C(g) At equilibrium,the concentration of A is 0.223 mol/L.What is the value of K_c?

Which of the following statements about the reaction quotient,Q,is false?

If the reaction quotient,Q,is greater than K in a gas phase reaction,then

Consider the reaction H₂ + I₂ 2HI for which K_c = 43.6 at a high temperature.If an equimolar mixture of reactants gives the concentration of the product to be 0.50 M at equilibrium,determine the equilibrium concentration of the hydrogen.

Write a balanced chemical equation which corresponds to the following equilibrium constant expression.

Which of the following equilibria would not be affected by pressure changes at constant temperature?

If the reaction quotient,Q,is equal to K in a gas phase reaction,then

For the equilibrium PCl₅(g) PCl₃(g)+ Cl₂(g),K_c = 4.0 at 228°C.If pure PCl₅ is placed in a 1.00-L container and allowed to come to equilibrium,and the equilibrium concentration of PCl₅(g)is 0.26 M,what is the equilibrium concentration of PCl₃?

Which expression correctly describes the equilibrium constant K_c for the following reaction?

A flask contains the following chemical system at equilibrium. CuCO₃(s) Cu²⁺(aq)+ 2 CO₃^2-(aq) Addition of which of the following substances will increase the solubility of CuCO₃(s)in water? 1)aqueous hydrochloric acid 2)aqueous sodium carbonate 3)solid copper(II)carbonate

Consider the following equilibrium: CO₂(g)+ H₂(g) CO(g)+ H₂O(g); K_c = 1.6 at 1260 K Suppose 0.038 mol CO₂ and 0.022 mol H₂are placed in a 1.50-L vessel at 1260 K.What is the equilibrium partial pressure of CO(g)? (R = 0.0821 L · atm/K·mol)

Basic Concepts of Chemistry

Mathlets Review: The Tools of Quantitative Chemistry

Atoms, molecules, and Ions

Chemical Reactions

Stoichiometry: Quantitative Information About Chemical Reactions

Principles of Chemical Reactivity: Energy and Chemical Reactions

The Structure of Atoms

The Structure of Atoms and Periodic Trends

Bonding and Molecular Structure

Bonding and Molecular Structure: Orbital Hybridization and Molecular Orbitals

Gases and Their Properties

Intermolecular Forces and Liquids

The Chemistry of Solids

Solutions and Their Behavior

Chemical Kinetics: the Rates of Chemical Reactions

The Chemistry of Acids and Bases

Principles of Reactivity: Other Aspects of Aqueous Equilibria

Entropy and Free Energy

Principles of Reactivity: Electron Transfer Reactions

Environmental Chemistry Earths Environment,energy,and Sustainability

The Chemistry of the Main Group Elements

The Chemistry of the Transition Elements

Carbon: Not Just Another Element

Biochemistry

Nuclear Chemistry

Filters

Exam 16: Principles of Reactivity: Chemical Equilibria

Given the following equilibria, Ni2+(aq)+ 2 OH-(aq) Ni(OH)2(s) ~~~~~~~~ K1 = 1.8 ×\times× 1015 Ni2+(aq)+ 4 CN-(aq) Ni(CN)42-(aq) ~~ ~~ K2 = 2.0 ×\times× 1031 Determine the equilibrium constant,Kc,for the following reaction. Ni(OH)2(s)+ 4 CN-(aq) Ni(CN)42-(aq)+ 2 OH-(aq)

Given the equilibrium constants for the following reactions: 4Cu(s)+ O2(g) 2Cu2O(s),K1 4CuO(s) 2Cu2O(s)+ O2(g),K2 What is K for the system 2Cu(s)+ O2(g) 2CuO(s) Equivalent to?

The thermochemical equation for the formation of ammonia from elemental nitrogen and hydrogen is as follows. N2(g)+ 3 H2(g) 2 NH3(g) ~~~~~~~~ ~~~~~~~~ Δ\DeltaΔ H = -92.2 kJ Given a system that is initially at equilibrium,which of the following actions cause the reaction to proceed to the left?

Sulfuryl chloride decomposes to sulfur dioxide and chlorine. SO2Cl2(g) SO2(g)+ Cl2(g) Kc is 0.045 at 648 K.If an initial concentration of 0.075 M SO2Cl2 is allowed to equilibrate,what is the equilibrium concentration of Cl2?

At a given temperature,K = 0.021 for the equilibrium: PCl5(g) PCl3(g)+ Cl2(g) What is K for: Cl2(g)+ PCl3(g) PCl5(g)?

For the reaction given below,2.00 moles of A and 3.00 moles of B are placed in a 6.00-L container. A(g)+ 2B(g) C(g) At equilibrium,the concentration of A is 0.223 mol/L.What is the value of Kc?

Which of the following statements about the reaction quotient,Q,is false?

The equilibrium constant,Kc,for the decomposition of ammonium hydrogen sulfide is 1.8 ×\times× 10-4 at 25 ∘\circ∘ C.NH4HS(s) NH3(g)+ H2S(g) If excess NH4HS(s)is allowed to equilibrate at 25 ∘\circ∘ C,what is the equilibrium concentration of NH3?

If the reaction quotient,Q,is greater than K in a gas phase reaction,then

Consider the reaction H2 + I2 2HI for which Kc = 43.6 at a high temperature.If an equimolar mixture of reactants gives the concentration of the product to be 0.50 M at equilibrium,determine the equilibrium concentration of the hydrogen.

Write a balanced chemical equation which corresponds to the following equilibrium constant expression.

Which of the following equilibria would not be affected by pressure changes at constant temperature?

If the reaction quotient,Q,is equal to K in a gas phase reaction,then

For the equilibrium PCl5(g) PCl3(g)+ Cl2(g),Kc = 4.0 at 228°C.If pure PCl5 is placed in a 1.00-L container and allowed to come to equilibrium,and the equilibrium concentration of PCl5(g)is 0.26 M,what is the equilibrium concentration of PCl3?

For the equilibrium PCl5(g) PCl3(g)+ Cl2(g),Kc = 2.0 ×\times× 101 at 240°C.If pure PCl5 is placed in a 1.00-L container and allowed to come to equilibrium,and the equilibrium concentration of PCl3(g)is 0.23 M,what is the equilibrium concentration of PCl5(g)?

Which expression correctly describes the equilibrium constant Kc for the following reaction?

A flask contains the following chemical system at equilibrium. CuCO3(s) Cu2+(aq)+ 2 CO32-(aq) Addition of which of the following substances will increase the solubility of CuCO3(s)in water? 1)aqueous hydrochloric acid 2)aqueous sodium carbonate 3)solid copper(II)carbonate

At a given temperature,0.0664 mol N2O4(g)is placed in a 1.00 L flask.After reaching equilibrium,the concentration of NO2(g)is 6.1 ×\times× 10-3 M.What is Kc for the reaction below?

Consider the following equilibrium: CO2(g)+ H2(g) CO(g)+ H2O(g); Kc = 1.6 at 1260 K Suppose 0.038 mol CO2 and 0.022 mol H2 are placed in a 1.50-L vessel at 1260 K.What is the equilibrium partial pressure of CO(g)? (R = 0.0821 L · atm/K·mol)

Basic Concepts of Chemistry

Mathlets Review: The Tools of Quantitative Chemistry

Atoms, molecules, and Ions

Chemical Reactions

Stoichiometry: Quantitative Information About Chemical Reactions

Principles of Chemical Reactivity: Energy and Chemical Reactions

The Structure of Atoms

The Structure of Atoms and Periodic Trends

Bonding and Molecular Structure

Bonding and Molecular Structure: Orbital Hybridization and Molecular Orbitals

Gases and Their Properties

Intermolecular Forces and Liquids

The Chemistry of Solids

Solutions and Their Behavior

Chemical Kinetics: the Rates of Chemical Reactions

The Chemistry of Acids and Bases

Principles of Reactivity: Other Aspects of Aqueous Equilibria

Entropy and Free Energy

Principles of Reactivity: Electron Transfer Reactions

Environmental Chemistry Earths Environment,energy,and Sustainability

The Chemistry of the Main Group Elements

The Chemistry of the Transition Elements

Carbon: Not Just Another Element

Biochemistry

Nuclear Chemistry

Filters

Given the equilibrium constants for the following reactions: 4Cu(s)+ O₂(g) 2Cu₂O(s),K₁ 4CuO(s) 2Cu₂O(s)+ O₂(g),K₂ What is K for the system 2Cu(s)+ O₂(g) 2CuO(s) Equivalent to?

Sulfuryl chloride decomposes to sulfur dioxide and chlorine. SO₂Cl₂(g) SO₂(g)+ Cl₂(g) K_c is 0.045 at 648 K.If an initial concentration of 0.075 M SO₂Cl₂ is allowed to equilibrate,what is the equilibrium concentration of Cl₂?

At a given temperature,K = 0.021 for the equilibrium: PCl₅(g) PCl₃(g)+ Cl₂(g) What is K for: Cl₂(g)+ PCl₃(g) PCl₅(g)?

For the reaction given below,2.00 moles of A and 3.00 moles of B are placed in a 6.00-L container. A(g)+ 2B(g) C(g) At equilibrium,the concentration of A is 0.223 mol/L.What is the value of K_c?

Consider the reaction H₂ + I₂ 2HI for which K_c = 43.6 at a high temperature.If an equimolar mixture of reactants gives the concentration of the product to be 0.50 M at equilibrium,determine the equilibrium concentration of the hydrogen.

For the equilibrium PCl₅(g) PCl₃(g)+ Cl₂(g),K_c = 4.0 at 228°C.If pure PCl₅ is placed in a 1.00-L container and allowed to come to equilibrium,and the equilibrium concentration of PCl₅(g)is 0.26 M,what is the equilibrium concentration of PCl₃?

Which expression correctly describes the equilibrium constant K_c for the following reaction?

A flask contains the following chemical system at equilibrium. CuCO₃(s) Cu²⁺(aq)+ 2 CO₃^2-(aq) Addition of which of the following substances will increase the solubility of CuCO₃(s)in water? 1)aqueous hydrochloric acid 2)aqueous sodium carbonate 3)solid copper(II)carbonate

Consider the following equilibrium: CO₂(g)+ H₂(g) CO(g)+ H₂O(g); K_c = 1.6 at 1260 K Suppose 0.038 mol CO₂ and 0.022 mol H₂are placed in a 1.50-L vessel at 1260 K.What is the equilibrium partial pressure of CO(g)? (R = 0.0821 L · atm/K·mol)